C14H10Br2FNO6 — CID 168536879
3,5-dibromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-6-fluorobenzoic acid (PubChem CID 168536879) has the molecular formula C14H10Br2FNO6 and a molecular weight of 467.04 g/mol. Its IUPAC name is 3,5-dibromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-6-fluorobenzoic acid.
| Compound Name | 3,5-dibromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 168536879 |
| Molecular Formula | C14H10Br2FNO6 |
| Molecular Weight | 467.04 g/mol |
| Exact Mass | 464.89 |
| IUPAC Name | 3,5-dibromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-6-fluorobenzoic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2c(Br)cc(Br)c(F)c2C(=O)O)C(=O)O1 |
| InChI | InChI=1S/C14H10Br2FNO6/c1-14(2)23-12(21)5(13(22)24-14)4-18-10-7(16)3-6(15)9(17)8(10)11(19)20/h3-4,18H,1-2H3,(H,19,20) |
| InChIKey | CPRDRNKBASBQAE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.04 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|