C17H18BrNO6 — CID 168538228
ethyl 3-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoate (PubChem CID 168538228) has the molecular formula C17H18BrNO6 and a molecular weight of 412.24 g/mol. Its IUPAC name is ethyl 3-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoate.
| Compound Name | ethyl 3-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoate |
|---|---|
| PubChem CID | 168538228 |
| Molecular Formula | C17H18BrNO6 |
| Molecular Weight | 412.24 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | ethyl 3-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-methylbenzoate |
| SMILES | CCOC(=O)c1cc(C)c(NC=C2C(=O)OC(C)(C)OC2=O)c(Br)c1 |
| InChI | InChI=1S/C17H18BrNO6/c1-5-23-14(20)10-6-9(2)13(12(18)7-10)19-8-11-15(21)24-17(3,4)25-16(11)22/h6-8,19H,5H2,1-4H3 |
| InChIKey | XWAIDEKENYDCGW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|