C14H10N2O11 — CID 59761965
2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-hydroxymethyl]-4,5-dinitrobenzoic acid (PubChem CID 59761965) has the molecular formula C14H10N2O11 and a molecular weight of 382.24 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-hydroxymethyl]-4,5-dinitrobenzoic acid.
| Compound Name | 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-hydroxymethyl]-4,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 59761965 |
| Molecular Formula | C14H10N2O11 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-hydroxymethyl]-4,5-dinitrobenzoic acid |
| SMILES | CC1(C)OC(=O)C(=C(O)c2cc([N+](=O)[O-])c([N+](=O)[O-])cc2C(=O)O)C(=O)O1 |
| InChI | InChI=1S/C14H10N2O11/c1-14(2)26-12(20)9(13(21)27-14)10(17)5-3-7(15(22)23)8(16(24)25)4-6(5)11(18)19/h3-4,17H,1-2H3,(H,18,19) |
| InChIKey | OSYSISWYAFAKLW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 196.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|