C17H19ClN2O6 — CID 168537827
5-[(4-tert-butyl-2-chloro-6-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168537827) has the molecular formula C17H19ClN2O6 and a molecular weight of 382.80 g/mol. Its IUPAC name is 5-[(4-tert-butyl-2-chloro-6-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-tert-butyl-2-chloro-6-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168537827 |
| Molecular Formula | C17H19ClN2O6 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 5-[(4-tert-butyl-2-chloro-6-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2c(Cl)cc(C(C)(C)C)cc2[N+](=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C17H19ClN2O6/c1-16(2,3)9-6-11(18)13(12(7-9)20(23)24)19-8-10-14(21)25-17(4,5)26-15(10)22/h6-8,19H,1-5H3 |
| InChIKey | QCSMORUMSZXBHT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|