C21H18ClNO10S2 — CID 168539760
2-[2-(4-chloro-2-sulfophenyl)ethenyl]-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzenesulfonic acid (PubChem CID 168539760) has the molecular formula C21H18ClNO10S2 and a molecular weight of 543.96 g/mol. Its IUPAC name is 2-[2-(4-chloro-2-sulfophenyl)ethenyl]-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzenesulfonic acid.
| Compound Name | 2-[2-(4-chloro-2-sulfophenyl)ethenyl]-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 168539760 |
| Molecular Formula | C21H18ClNO10S2 |
| Molecular Weight | 543.96 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | 2-[2-(4-chloro-2-sulfophenyl)ethenyl]-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzenesulfonic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc(C=Cc3ccc(Cl)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)C(=O)O1 |
| InChI | InChI=1S/C21H18ClNO10S2/c1-21(2)32-19(24)16(20(25)33-21)11-23-15-8-6-13(18(10-15)35(29,30)31)4-3-12-5-7-14(22)9-17(12)34(26,27)28/h3-11,23H,1-2H3,(H,26,27,28)(H,29,30,31) |
| InChIKey | SDUFEJDHKUPXPN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 173.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.96 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|