C16H20N2O6S2 — CID 21028163
5-(methylamino)-2-[(E)-2-[4-(methylamino)-2-(trihydroxy-λ4-sulfanyl)phenyl]ethenyl]benzenesulfonic acid (PubChem CID 21028163) has the molecular formula C16H20N2O6S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 5-(methylamino)-2-[(E)-2-[4-(methylamino)-2-(trihydroxy-λ4-sulfanyl)phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-(methylamino)-2-[(E)-2-[4-(methylamino)-2-(trihydroxy-λ4-sulfanyl)phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 21028163 |
| Molecular Formula | C16H20N2O6S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 5-(methylamino)-2-[(E)-2-[4-(methylamino)-2-(trihydroxy-λ4-sulfanyl)phenyl]ethenyl]benzenesulfonic acid |
| SMILES | CNc1ccc(/C=C/c2ccc(NC)cc2S(=O)(=O)O)c(S(O)(O)O)c1 |
| InChI | InChI=1S/C16H20N2O6S2/c1-17-13-7-5-11(15(9-13)25(19,20)21)3-4-12-6-8-14(18-2)10-16(12)26(22,23)24/h3-10,17-21H,1-2H3,(H,22,23,24)/b4-3+ |
| InChIKey | HGWLGPFLGVFMCN-ONEGZZNKSA-N |
| XLogP | 3.77 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|