C14H17N3O3S — CID 18343804
5-(methylamino)-2-[4-(methylamino)anilino]benzenesulfonic acid (PubChem CID 18343804) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 5-(methylamino)-2-[4-(methylamino)anilino]benzenesulfonic acid.
| Compound Name | 5-(methylamino)-2-[4-(methylamino)anilino]benzenesulfonic acid |
|---|---|
| PubChem CID | 18343804 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 5-(methylamino)-2-[4-(methylamino)anilino]benzenesulfonic acid |
| SMILES | CNc1ccc(Nc2ccc(NC)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H17N3O3S/c1-15-10-3-5-11(6-4-10)17-13-8-7-12(16-2)9-14(13)21(18,19)20/h3-9,15-17H,1-2H3,(H,18,19,20) |
| InChIKey | UNULTUDZCRBCGA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|