C17H20N2O3S — CID 18716024
5-(methylamino)-2-[(E)-2-[2-methyl-4-(methylamino)phenyl]ethenyl]benzenesulfonic acid (PubChem CID 18716024) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 5-(methylamino)-2-[(E)-2-[2-methyl-4-(methylamino)phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-(methylamino)-2-[(E)-2-[2-methyl-4-(methylamino)phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 18716024 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-(methylamino)-2-[(E)-2-[2-methyl-4-(methylamino)phenyl]ethenyl]benzenesulfonic acid |
| SMILES | CNc1ccc(/C=C/c2ccc(NC)cc2S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H20N2O3S/c1-12-10-15(18-2)8-6-13(12)4-5-14-7-9-16(19-3)11-17(14)23(20,21)22/h4-11,18-19H,1-3H3,(H,20,21,22)/b5-4+ |
| InChIKey | CLCPLRWCUKITAQ-SNAWJCMRSA-N |
| XLogP | 3.50 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|