C28H25N4NaO8S2 — CID 174159816
sodium;hydride;5-(phenylcarbamoylamino)-2-[2-[4-(phenylcarbamoylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 174159816) has the molecular formula C28H25N4NaO8S2 and a molecular weight of 632.65 g/mol. Its IUPAC name is sodium;hydride;5-(phenylcarbamoylamino)-2-[2-[4-(phenylcarbamoylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | sodium;hydride;5-(phenylcarbamoylamino)-2-[2-[4-(phenylcarbamoylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 174159816 |
| Molecular Formula | C28H25N4NaO8S2 |
| Molecular Weight | 632.65 g/mol |
| Exact Mass | 632.10 |
| IUPAC Name | sodium;hydride;5-(phenylcarbamoylamino)-2-[2-[4-(phenylcarbamoylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C=Cc2ccc(NC(=O)Nc3ccccc3)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C28H24N4O8S2.Na.H/c33-27(29-21-7-3-1-4-8-21)31-23-15-13-19(25(17-23)41(35,36)37)11-12-20-14-16-24(18-26(20)42(38,39)40)32-28(34)30-22-9-5-2-6-10-22;;/h1-18H,(H2,29,31,33)(H2,30,32,34)(H,35,36,37)(H,38,39,40);;/q;+1;-1 |
| InChIKey | MCGAMDHHUCQQAM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|