C15H15N3O5S — CID 173100746
2-(methylcarbamoyl)-5-(phenylcarbamoylamino)benzenesulfonic acid (PubChem CID 173100746) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-(methylcarbamoyl)-5-(phenylcarbamoylamino)benzenesulfonic acid.
| Compound Name | 2-(methylcarbamoyl)-5-(phenylcarbamoylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 173100746 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-(methylcarbamoyl)-5-(phenylcarbamoylamino)benzenesulfonic acid |
| SMILES | CNC(=O)c1ccc(NC(=O)Nc2ccccc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C15H15N3O5S/c1-16-14(19)12-8-7-11(9-13(12)24(21,22)23)18-15(20)17-10-5-3-2-4-6-10/h2-9H,1H3,(H,16,19)(H2,17,18,20)(H,21,22,23) |
| InChIKey | DOOGLIHZZWZEBM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|