C22H22N2O4S — CID 174228207
2-[2,6-dimethyl-4-(phenylcarbamoylamino)phenyl]-4-methylbenzenesulfonic acid (PubChem CID 174228207) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-(phenylcarbamoylamino)phenyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[2,6-dimethyl-4-(phenylcarbamoylamino)phenyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174228207 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[2,6-dimethyl-4-(phenylcarbamoylamino)phenyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(-c2c(C)cc(NC(=O)Nc3ccccc3)cc2C)c1 |
| InChI | InChI=1S/C22H22N2O4S/c1-14-9-10-20(29(26,27)28)19(11-14)21-15(2)12-18(13-16(21)3)24-22(25)23-17-7-5-4-6-8-17/h4-13H,1-3H3,(H2,23,24,25)(H,26,27,28) |
| InChIKey | WTWYGMXHLKMXHR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|