C26H21N3O5S — CID 170308775
4-benzamido-2-[4-(phenylcarbamoylamino)phenyl]benzenesulfonic acid (PubChem CID 170308775) has the molecular formula C26H21N3O5S and a molecular weight of 487.54 g/mol. Its IUPAC name is 4-benzamido-2-[4-(phenylcarbamoylamino)phenyl]benzenesulfonic acid.
| Compound Name | 4-benzamido-2-[4-(phenylcarbamoylamino)phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 170308775 |
| Molecular Formula | C26H21N3O5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 4-benzamido-2-[4-(phenylcarbamoylamino)phenyl]benzenesulfonic acid |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(-c2cc(NC(=O)c3ccccc3)ccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C26H21N3O5S/c30-25(19-7-3-1-4-8-19)27-22-15-16-24(35(32,33)34)23(17-22)18-11-13-21(14-12-18)29-26(31)28-20-9-5-2-6-10-20/h1-17H,(H,27,30)(H2,28,29,31)(H,32,33,34) |
| InChIKey | OBRAQTIGUHFIIX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|