C21H17N3O3 — CID 57312492
2-(4-benzamidophenyl)benzene-1,4-dicarboxamide (PubChem CID 57312492) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-(4-benzamidophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 2-(4-benzamidophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 57312492 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-(4-benzamidophenyl)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c(-c2ccc(NC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C21H17N3O3/c22-19(25)15-8-11-17(20(23)26)18(12-15)13-6-9-16(10-7-13)24-21(27)14-4-2-1-3-5-14/h1-12H,(H2,22,25)(H2,23,26)(H,24,27) |
| InChIKey | VSNWWLIQZZFUPO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |