C15H15N3O4S — CID 22564876
3-(benzenesulfonylcarbamoylamino)-N-methylbenzamide (PubChem CID 22564876) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is 3-(benzenesulfonylcarbamoylamino)-N-methylbenzamide.
| Compound Name | 3-(benzenesulfonylcarbamoylamino)-N-methylbenzamide |
|---|---|
| PubChem CID | 22564876 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-(benzenesulfonylcarbamoylamino)-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H15N3O4S/c1-16-14(19)11-6-5-7-12(10-11)17-15(20)18-23(21,22)13-8-3-2-4-9-13/h2-10H,1H3,(H,16,19)(H2,17,18,20) |
| InChIKey | PZYVNBGQTHWPFX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |