C27H23N3O5S — CID 142738756
N-methyl-3-[[3-[(3-phenoxyphenyl)sulfamoyl]benzoyl]amino]benzamide (PubChem CID 142738756) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is N-methyl-3-[[3-[(3-phenoxyphenyl)sulfamoyl]benzoyl]amino]benzamide.
| Compound Name | N-methyl-3-[[3-[(3-phenoxyphenyl)sulfamoyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 142738756 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | N-methyl-3-[[3-[(3-phenoxyphenyl)sulfamoyl]benzoyl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2cccc(S(=O)(=O)Nc3cccc(Oc4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C27H23N3O5S/c1-28-26(31)19-8-5-10-21(16-19)29-27(32)20-9-6-15-25(17-20)36(33,34)30-22-11-7-14-24(18-22)35-23-12-3-2-4-13-23/h2-18,30H,1H3,(H,28,31)(H,29,32) |
| InChIKey | NAUJZIAIAZQHKG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |