C26H21N3O5S — CID 142738706
3-[[3-[(3-phenoxyphenyl)sulfamoyl]benzoyl]amino]benzamide (PubChem CID 142738706) has the molecular formula C26H21N3O5S and a molecular weight of 487.54 g/mol. Its IUPAC name is 3-[[3-[(3-phenoxyphenyl)sulfamoyl]benzoyl]amino]benzamide.
| Compound Name | 3-[[3-[(3-phenoxyphenyl)sulfamoyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 142738706 |
| Molecular Formula | C26H21N3O5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 3-[[3-[(3-phenoxyphenyl)sulfamoyl]benzoyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(NC(=O)c2cccc(S(=O)(=O)Nc3cccc(Oc4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C26H21N3O5S/c27-25(30)18-7-4-9-20(15-18)28-26(31)19-8-5-14-24(16-19)35(32,33)29-21-10-6-13-23(17-21)34-22-11-2-1-3-12-22/h1-17,29H,(H2,27,30)(H,28,31) |
| InChIKey | OBLJHRWNLBZUES-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |