C21H17N3O4S — CID 55973067
3-(benzenesulfonamido)-N-[3-(cyanomethoxy)phenyl]benzamide (PubChem CID 55973067) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[3-(cyanomethoxy)phenyl]benzamide.
| Compound Name | 3-(benzenesulfonamido)-N-[3-(cyanomethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 55973067 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[3-(cyanomethoxy)phenyl]benzamide |
| SMILES | N#CCOc1cccc(NC(=O)c2cccc(NS(=O)(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C21H17N3O4S/c22-12-13-28-19-9-5-7-17(15-19)23-21(25)16-6-4-8-18(14-16)24-29(26,27)20-10-2-1-3-11-20/h1-11,14-15,24H,13H2,(H,23,25) |
| InChIKey | FMGAVIFQFVDUNK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |