C19H28N2O3S — CID 91616190
1-(benzenesulfonyl)-3-(3,4-dimethylphenyl)urea;ethane (PubChem CID 91616190) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(3,4-dimethylphenyl)urea;ethane.
| Compound Name | 1-(benzenesulfonyl)-3-(3,4-dimethylphenyl)urea;ethane |
|---|---|
| PubChem CID | 91616190 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(3,4-dimethylphenyl)urea;ethane |
| SMILES | CC.CC.Cc1ccc(NC(=O)NS(=O)(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C15H16N2O3S.2C2H6/c1-11-8-9-13(10-12(11)2)16-15(18)17-21(19,20)14-6-4-3-5-7-14;2*1-2/h3-10H,1-2H3,(H2,16,17,18);2*1-2H3 |
| InChIKey | WFNBCMDBLWRAES-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |