C28H22N2NaO10S2+ — CID 54611301
sodium 5-[(2-hydroxybenzoyl)amino]-2-[(E)-2-[4-[(2-hydroxybenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 54611301) has the molecular formula C28H22N2NaO10S2+ and a molecular weight of 633.61 g/mol. Its IUPAC name is sodium 5-[(2-hydroxybenzoyl)amino]-2-[(E)-2-[4-[(2-hydroxybenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | sodium 5-[(2-hydroxybenzoyl)amino]-2-[(E)-2-[4-[(2-hydroxybenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54611301 |
| Molecular Formula | C28H22N2NaO10S2+ |
| Molecular Weight | 633.61 g/mol |
| Exact Mass | 633.06 |
| IUPAC Name | sodium 5-[(2-hydroxybenzoyl)amino]-2-[(E)-2-[4-[(2-hydroxybenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=C(Nc1ccc(/C=C/c2ccc(NC(=O)c3ccccc3O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1)c1ccccc1O.[Na+] |
| InChI | InChI=1S/C28H22N2O10S2.Na/c31-23-7-3-1-5-21(23)27(33)29-19-13-11-17(25(15-19)41(35,36)37)9-10-18-12-14-20(16-26(18)42(38,39)40)30-28(34)22-6-2-4-8-24(22)32;/h1-16,31-32H,(H,29,33)(H,30,34)(H,35,36,37)(H,38,39,40);/q;+1/b10-9+; |
| InChIKey | JBGKJMNRTRPZQQ-RRABGKBLSA-N |
| XLogP | 1.27 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.61 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|