C16H16N2NaO6S3+ — CID 71487572
sodium 5-(methylcarbamothioylamino)-2-[(E)-2-(2-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 71487572) has the molecular formula C16H16N2NaO6S3+ and a molecular weight of 451.50 g/mol. Its IUPAC name is sodium 5-(methylcarbamothioylamino)-2-[(E)-2-(2-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | sodium 5-(methylcarbamothioylamino)-2-[(E)-2-(2-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 71487572 |
| Molecular Formula | C16H16N2NaO6S3+ |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | sodium 5-(methylcarbamothioylamino)-2-[(E)-2-(2-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | CNC(=S)Nc1ccc(/C=C/c2ccccc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[Na+] |
| InChI | InChI=1S/C16H16N2O6S3.Na/c1-17-16(25)18-13-9-8-12(15(10-13)27(22,23)24)7-6-11-4-2-3-5-14(11)26(19,20)21;/h2-10H,1H3,(H2,17,18,25)(H,19,20,21)(H,22,23,24);/q;+1/b7-6+; |
| InChIKey | RCDANTXUDTWNNQ-UHDJGPCESA-N |
| XLogP | -0.73 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|