C21H23N3O8S3 — CID 71487267
2-[(E)-2-[4-(cyclopropylcarbamothioylamino)-2-sulfophenyl]ethenyl]-5-[(2-methoxyacetyl)amino]benzenesulfonic acid (PubChem CID 71487267) has the molecular formula C21H23N3O8S3 and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[(E)-2-[4-(cyclopropylcarbamothioylamino)-2-sulfophenyl]ethenyl]-5-[(2-methoxyacetyl)amino]benzenesulfonic acid.
| Compound Name | 2-[(E)-2-[4-(cyclopropylcarbamothioylamino)-2-sulfophenyl]ethenyl]-5-[(2-methoxyacetyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 71487267 |
| Molecular Formula | C21H23N3O8S3 |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | 2-[(E)-2-[4-(cyclopropylcarbamothioylamino)-2-sulfophenyl]ethenyl]-5-[(2-methoxyacetyl)amino]benzenesulfonic acid |
| SMILES | COCC(=O)Nc1ccc(/C=C/c2ccc(NC(=S)NC3CC3)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C21H23N3O8S3/c1-32-12-20(25)22-16-6-4-13(18(10-16)34(26,27)28)2-3-14-5-7-17(11-19(14)35(29,30)31)24-21(33)23-15-8-9-15/h2-7,10-11,15H,8-9,12H2,1H3,(H,22,25)(H2,23,24,33)(H,26,27,28)(H,29,30,31)/b3-2+ |
| InChIKey | RFKNVCOGEFNHBW-NSCUHMNNSA-N |
| XLogP | 2.38 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|