C20H20N2Na2O10S3 — CID 159510163
disodium;2-[2-[4-(cyclopropylsulfonylamino)-2-sulfonatophenyl]ethenyl]-5-[(2-methoxyacetyl)amino]benzenesulfonate (PubChem CID 159510163) has the molecular formula C20H20N2Na2O10S3 and a molecular weight of 590.57 g/mol. Its IUPAC name is disodium;2-[2-[4-(cyclopropylsulfonylamino)-2-sulfonatophenyl]ethenyl]-5-[(2-methoxyacetyl)amino]benzenesulfonate.
| Compound Name | disodium;2-[2-[4-(cyclopropylsulfonylamino)-2-sulfonatophenyl]ethenyl]-5-[(2-methoxyacetyl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 159510163 |
| Molecular Formula | C20H20N2Na2O10S3 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | disodium;2-[2-[4-(cyclopropylsulfonylamino)-2-sulfonatophenyl]ethenyl]-5-[(2-methoxyacetyl)amino]benzenesulfonate |
| SMILES | COCC(=O)Nc1ccc(C=Cc2ccc(NS(=O)(=O)C3CC3)cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C20H22N2O10S3.2Na/c1-32-12-20(23)21-15-6-4-13(18(10-15)34(26,27)28)2-3-14-5-7-16(11-19(14)35(29,30)31)22-33(24,25)17-8-9-17;;/h2-7,10-11,17,22H,8-9,12H2,1H3,(H,21,23)(H,26,27,28)(H,29,30,31);;/q;2*+1/p-2 |
| InChIKey | MAMLKUWXBOSDOK-UHFFFAOYSA-L |
| XLogP | -4.84 |
| TPSA | 198.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | -4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|