C20H22N2Na2O10S3 — CID 140612051
disodium;5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-(propan-2-ylsulfonylamino)-2-sulfonatophenyl]ethenyl]benzenesulfonate (PubChem CID 140612051) has the molecular formula C20H22N2Na2O10S3 and a molecular weight of 592.58 g/mol. Its IUPAC name is disodium;5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-(propan-2-ylsulfonylamino)-2-sulfonatophenyl]ethenyl]benzenesulfonate.
| Compound Name | disodium;5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-(propan-2-ylsulfonylamino)-2-sulfonatophenyl]ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 140612051 |
| Molecular Formula | C20H22N2Na2O10S3 |
| Molecular Weight | 592.58 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | disodium;5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-(propan-2-ylsulfonylamino)-2-sulfonatophenyl]ethenyl]benzenesulfonate |
| SMILES | COCC(=O)Nc1ccc(/C=C/c2ccc(NS(=O)(=O)C(C)C)cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C20H24N2O10S3.2Na/c1-13(2)33(24,25)22-17-9-7-15(19(11-17)35(29,30)31)5-4-14-6-8-16(21-20(23)12-32-3)10-18(14)34(26,27)28;;/h4-11,13,22H,12H2,1-3H3,(H,21,23)(H,26,27,28)(H,29,30,31);;/q;2*+1/p-2/b5-4+;; |
| InChIKey | AGUVSZDXPDNVRZ-SFKRKKMESA-L |
| XLogP | -4.59 |
| TPSA | 198.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.58 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|