C18H18N2Na2O7S2 — CID 140612062
disodium;5-(propan-2-ylcarbamoylamino)-2-[(E)-2-(2-sulfonatophenyl)ethenyl]benzenesulfonate (PubChem CID 140612062) has the molecular formula C18H18N2Na2O7S2 and a molecular weight of 484.46 g/mol. Its IUPAC name is disodium;5-(propan-2-ylcarbamoylamino)-2-[(E)-2-(2-sulfonatophenyl)ethenyl]benzenesulfonate.
| Compound Name | disodium;5-(propan-2-ylcarbamoylamino)-2-[(E)-2-(2-sulfonatophenyl)ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 140612062 |
| Molecular Formula | C18H18N2Na2O7S2 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | disodium;5-(propan-2-ylcarbamoylamino)-2-[(E)-2-(2-sulfonatophenyl)ethenyl]benzenesulfonate |
| SMILES | CC(C)NC(=O)Nc1ccc(/C=C/c2ccccc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C18H20N2O7S2.2Na/c1-12(2)19-18(21)20-15-10-9-14(17(11-15)29(25,26)27)8-7-13-5-3-4-6-16(13)28(22,23)24;;/h3-12H,1-2H3,(H2,19,20,21)(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2/b8-7+;; |
| InChIKey | YKORNUVXYKMEEP-MIIBGCIDSA-L |
| XLogP | -3.80 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|