C35H27N5O9S2-2 — CID 5163953
5-[(4-aminobenzoyl)amino]-2-[2-[4-[[4-[(4-aminobenzoyl)amino]benzoyl]amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate (PubChem CID 5163953) has the molecular formula C35H27N5O9S2-2 and a molecular weight of 725.76 g/mol. Its IUPAC name is 5-[(4-aminobenzoyl)amino]-2-[2-[4-[[4-[(4-aminobenzoyl)amino]benzoyl]amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate.
| Compound Name | 5-[(4-aminobenzoyl)amino]-2-[2-[4-[[4-[(4-aminobenzoyl)amino]benzoyl]amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 5163953 |
| Molecular Formula | C35H27N5O9S2-2 |
| Molecular Weight | 725.76 g/mol |
| Exact Mass | 725.13 |
| IUPAC Name | 5-[(4-aminobenzoyl)amino]-2-[2-[4-[[4-[(4-aminobenzoyl)amino]benzoyl]amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
| SMILES | Nc1ccc(C(=O)Nc2ccc(C(=O)Nc3ccc(C=Cc4ccc(NC(=O)c5ccc(N)cc5)cc4S(=O)(=O)[O-])c(S(=O)(=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C35H29N5O9S2/c36-26-11-3-23(4-12-26)33(41)38-28-15-9-25(10-16-28)35(43)40-30-18-8-22(32(20-30)51(47,48)49)2-1-21-7-17-29(19-31(21)50(44,45)46)39-34(42)24-5-13-27(37)14-6-24/h1-20H,36-37H2,(H,38,41)(H,39,42)(H,40,43)(H,44,45,46)(H,47,48,49)/p-2 |
| InChIKey | MBAYXHSGMOCFTK-UHFFFAOYSA-L |
| XLogP | 4.59 |
| TPSA | 253.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|