C15H16N2O6S2 — CID 11257609
2-[4-[(4-aminobenzoyl)amino]phenyl]sulfonylethanesulfonic acid (PubChem CID 11257609) has the molecular formula C15H16N2O6S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[4-[(4-aminobenzoyl)amino]phenyl]sulfonylethanesulfonic acid.
| Compound Name | 2-[4-[(4-aminobenzoyl)amino]phenyl]sulfonylethanesulfonic acid |
|---|---|
| PubChem CID | 11257609 |
| Molecular Formula | C15H16N2O6S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-[4-[(4-aminobenzoyl)amino]phenyl]sulfonylethanesulfonic acid |
| SMILES | Nc1ccc(C(=O)Nc2ccc(S(=O)(=O)CCS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C15H16N2O6S2/c16-12-3-1-11(2-4-12)15(18)17-13-5-7-14(8-6-13)24(19,20)9-10-25(21,22)23/h1-8H,9-10,16H2,(H,17,18)(H,21,22,23) |
| InChIKey | VRKBIAVCHYQPIS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|