C17H21N3O3S — CID 90104457
N-(4-aminophenyl)-4-[(2-methylsulfonylethylamino)methyl]benzamide (PubChem CID 90104457) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-[(2-methylsulfonylethylamino)methyl]benzamide.
| Compound Name | N-(4-aminophenyl)-4-[(2-methylsulfonylethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 90104457 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-(4-aminophenyl)-4-[(2-methylsulfonylethylamino)methyl]benzamide |
| SMILES | CS(=O)(=O)CCNCc1ccc(C(=O)Nc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-24(22,23)11-10-19-12-13-2-4-14(5-3-13)17(21)20-16-8-6-15(18)7-9-16/h2-9,19H,10-12,18H2,1H3,(H,20,21) |
| InChIKey | HEGFYMNRKREOJK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|