C24H26N4O2 — CID 170362896
4-N-[4-(2-aminoethyl)phenyl]-1-N-[2-(4-aminophenyl)ethyl]benzene-1,4-dicarboxamide (PubChem CID 170362896) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-N-[4-(2-aminoethyl)phenyl]-1-N-[2-(4-aminophenyl)ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[4-(2-aminoethyl)phenyl]-1-N-[2-(4-aminophenyl)ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 170362896 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 4-N-[4-(2-aminoethyl)phenyl]-1-N-[2-(4-aminophenyl)ethyl]benzene-1,4-dicarboxamide |
| SMILES | NCCc1ccc(NC(=O)c2ccc(C(=O)NCCc3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O2/c25-15-13-17-3-11-22(12-4-17)28-24(30)20-7-5-19(6-8-20)23(29)27-16-14-18-1-9-21(26)10-2-18/h1-12H,13-16,25-26H2,(H,27,29)(H,28,30) |
| InChIKey | RDSUJMQVJMTNKE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|