C26H26N4O4 — CID 169262539
1-N-[4-(2-aminoethyl)phenyl]-4-N-[4-[2-(diformylamino)ethyl]phenyl]benzene-1,4-dicarboxamide (PubChem CID 169262539) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 1-N-[4-(2-aminoethyl)phenyl]-4-N-[4-[2-(diformylamino)ethyl]phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N-[4-(2-aminoethyl)phenyl]-4-N-[4-[2-(diformylamino)ethyl]phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 169262539 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-N-[4-(2-aminoethyl)phenyl]-4-N-[4-[2-(diformylamino)ethyl]phenyl]benzene-1,4-dicarboxamide |
| SMILES | NCCc1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(CCN(C=O)C=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O4/c27-15-13-19-1-9-23(10-2-19)28-25(33)21-5-7-22(8-6-21)26(34)29-24-11-3-20(4-12-24)14-16-30(17-31)18-32/h1-12,17-18H,13-16,27H2,(H,28,33)(H,29,34) |
| InChIKey | YDUCBTRGBDWXAM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|