C32H27N3O14S4 — CID 173270175
2-[2-[4-[[4-(2-amino-2-oxoethyl)sulfonylbenzoyl]amino]-2-sulfophenyl]ethenyl]-5-[[4-(2-oxoethylsulfonyl)benzoyl]amino]benzenesulfonic acid (PubChem CID 173270175) has the molecular formula C32H27N3O14S4 and a molecular weight of 805.84 g/mol. Its IUPAC name is 2-[2-[4-[[4-(2-amino-2-oxoethyl)sulfonylbenzoyl]amino]-2-sulfophenyl]ethenyl]-5-[[4-(2-oxoethylsulfonyl)benzoyl]amino]benzenesulfonic acid.
| Compound Name | 2-[2-[4-[[4-(2-amino-2-oxoethyl)sulfonylbenzoyl]amino]-2-sulfophenyl]ethenyl]-5-[[4-(2-oxoethylsulfonyl)benzoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 173270175 |
| Molecular Formula | C32H27N3O14S4 |
| Molecular Weight | 805.84 g/mol |
| Exact Mass | 805.04 |
| IUPAC Name | 2-[2-[4-[[4-(2-amino-2-oxoethyl)sulfonylbenzoyl]amino]-2-sulfophenyl]ethenyl]-5-[[4-(2-oxoethylsulfonyl)benzoyl]amino]benzenesulfonic acid |
| SMILES | NC(=O)CS(=O)(=O)c1ccc(C(=O)Nc2ccc(C=Cc3ccc(NC(=O)c4ccc(S(=O)(=O)CC=O)cc4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C32H27N3O14S4/c33-30(37)19-51(42,43)27-13-7-23(8-14-27)32(39)35-25-10-4-21(29(18-25)53(47,48)49)2-1-20-3-9-24(17-28(20)52(44,45)46)34-31(38)22-5-11-26(12-6-22)50(40,41)16-15-36/h1-15,17-18H,16,19H2,(H2,33,37)(H,34,38)(H,35,39)(H,44,45,46)(H,47,48,49) |
| InChIKey | PHKWEDNVAAEVET-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 295.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.84 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|