C30H24N4O16S4 — CID 54196409
5-[(4-methylsulfonyl-3-nitrobenzoyl)amino]-2-[2-[4-[(4-methylsulfonyl-3-nitrobenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 54196409) has the molecular formula C30H24N4O16S4 and a molecular weight of 824.80 g/mol. Its IUPAC name is 5-[(4-methylsulfonyl-3-nitrobenzoyl)amino]-2-[2-[4-[(4-methylsulfonyl-3-nitrobenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(4-methylsulfonyl-3-nitrobenzoyl)amino]-2-[2-[4-[(4-methylsulfonyl-3-nitrobenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54196409 |
| Molecular Formula | C30H24N4O16S4 |
| Molecular Weight | 824.80 g/mol |
| Exact Mass | 824.01 |
| IUPAC Name | 5-[(4-methylsulfonyl-3-nitrobenzoyl)amino]-2-[2-[4-[(4-methylsulfonyl-3-nitrobenzoyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(C=Cc3ccc(NC(=O)c4ccc(S(C)(=O)=O)c([N+](=O)[O-])c4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H24N4O16S4/c1-51(41,42)25-11-7-19(13-23(25)33(37)38)29(35)31-21-9-5-17(27(15-21)53(45,46)47)3-4-18-6-10-22(16-28(18)54(48,49)50)32-30(36)20-8-12-26(52(2,43)44)24(14-20)34(39)40/h3-16H,1-2H3,(H,31,35)(H,32,36)(H,45,46,47)(H,48,49,50) |
| InChIKey | PMCTUSFLRXIBPG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 321.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|