C14H11FN2O5S — CID 26114846
N-(2-fluorophenyl)-4-methylsulfonyl-3-nitrobenzamide (PubChem CID 26114846) has the molecular formula C14H11FN2O5S and a molecular weight of 338.32 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-methylsulfonyl-3-nitrobenzamide.
| Compound Name | N-(2-fluorophenyl)-4-methylsulfonyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26114846 |
| Molecular Formula | C14H11FN2O5S |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-(2-fluorophenyl)-4-methylsulfonyl-3-nitrobenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccccc2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11FN2O5S/c1-23(21,22)13-7-6-9(8-12(13)17(19)20)14(18)16-11-5-3-2-4-10(11)15/h2-8H,1H3,(H,16,18) |
| InChIKey | YBJBPXNHVDBNST-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|