C19H17N3O8S2 — CID 4849467
N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-4-methylsulfonyl-3-nitrobenzamide (PubChem CID 4849467) has the molecular formula C19H17N3O8S2 and a molecular weight of 479.49 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-4-methylsulfonyl-3-nitrobenzamide.
| Compound Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-4-methylsulfonyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4849467 |
| Molecular Formula | C19H17N3O8S2 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-4-methylsulfonyl-3-nitrobenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(S(=O)(=O)NCc3ccco3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17N3O8S2/c1-31(26,27)18-9-4-13(11-17(18)22(24)25)19(23)21-14-5-7-16(8-6-14)32(28,29)20-12-15-3-2-10-30-15/h2-11,20H,12H2,1H3,(H,21,23) |
| InChIKey | PQIASQHWGYDISW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|