C20H23N3NaO7S3+ — CID 71487137
sodium 5-acetamido-2-[(E)-2-[4-(propan-2-ylcarbamothioylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 71487137) has the molecular formula C20H23N3NaO7S3+ and a molecular weight of 536.61 g/mol. Its IUPAC name is sodium 5-acetamido-2-[(E)-2-[4-(propan-2-ylcarbamothioylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | sodium 5-acetamido-2-[(E)-2-[4-(propan-2-ylcarbamothioylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 71487137 |
| Molecular Formula | C20H23N3NaO7S3+ |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | sodium 5-acetamido-2-[(E)-2-[4-(propan-2-ylcarbamothioylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | CC(=O)Nc1ccc(/C=C/c2ccc(NC(=S)NC(C)C)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[Na+] |
| InChI | InChI=1S/C20H23N3O7S3.Na/c1-12(2)21-20(31)23-17-9-7-15(19(11-17)33(28,29)30)5-4-14-6-8-16(22-13(3)24)10-18(14)32(25,26)27;/h4-12H,1-3H3,(H,22,24)(H2,21,23,31)(H,25,26,27)(H,28,29,30);/q;+1/b5-4+; |
| InChIKey | XJXLMYJTUQAXTR-FXRZFVDSSA-N |
| XLogP | 0.01 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|