C20H25N5O3S3 — CID 155258457
N-[3-aminosulfanyl-4-[(E)-2-[4-(propan-2-ylcarbamothioylamino)-2-sulfamoylphenyl]ethenyl]phenyl]acetamide (PubChem CID 155258457) has the molecular formula C20H25N5O3S3 and a molecular weight of 479.65 g/mol. Its IUPAC name is N-[3-aminosulfanyl-4-[(E)-2-[4-(propan-2-ylcarbamothioylamino)-2-sulfamoylphenyl]ethenyl]phenyl]acetamide.
| Compound Name | N-[3-aminosulfanyl-4-[(E)-2-[4-(propan-2-ylcarbamothioylamino)-2-sulfamoylphenyl]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 155258457 |
| Molecular Formula | C20H25N5O3S3 |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[3-aminosulfanyl-4-[(E)-2-[4-(propan-2-ylcarbamothioylamino)-2-sulfamoylphenyl]ethenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C/c2ccc(NC(=S)NC(C)C)cc2S(N)(=O)=O)c(SN)c1 |
| InChI | InChI=1S/C20H25N5O3S3/c1-12(2)23-20(29)25-17-9-7-15(19(11-17)31(22,27)28)5-4-14-6-8-16(24-13(3)26)10-18(14)30-21/h4-12H,21H2,1-3H3,(H,24,26)(H2,22,27,28)(H2,23,25,29)/b5-4+ |
| InChIKey | KQWSRMVCLNYENB-SNAWJCMRSA-N |
| XLogP | 3.12 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|