C21H26N2O6S3 — CID 140825047
propan-2-yl 2-[2-(benzenesulfonyloxy)ethenyl]-5-(propan-2-ylcarbamothioylamino)benzenesulfonate (PubChem CID 140825047) has the molecular formula C21H26N2O6S3 and a molecular weight of 498.65 g/mol. Its IUPAC name is propan-2-yl 2-[2-(benzenesulfonyloxy)ethenyl]-5-(propan-2-ylcarbamothioylamino)benzenesulfonate.
| Compound Name | propan-2-yl 2-[2-(benzenesulfonyloxy)ethenyl]-5-(propan-2-ylcarbamothioylamino)benzenesulfonate |
|---|---|
| PubChem CID | 140825047 |
| Molecular Formula | C21H26N2O6S3 |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | propan-2-yl 2-[2-(benzenesulfonyloxy)ethenyl]-5-(propan-2-ylcarbamothioylamino)benzenesulfonate |
| SMILES | CC(C)NC(=S)Nc1ccc(C=COS(=O)(=O)c2ccccc2)c(S(=O)(=O)OC(C)C)c1 |
| InChI | InChI=1S/C21H26N2O6S3/c1-15(2)22-21(30)23-18-11-10-17(20(14-18)32(26,27)29-16(3)4)12-13-28-31(24,25)19-8-6-5-7-9-19/h5-16H,1-4H3,(H2,22,23,30) |
| InChIKey | REIHREVWSLJBNY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|