C30H26N2O10S2 — CID 171353983
methyl 2-[(E)-2-[2-methoxysulfonyl-4-(phenoxycarbonylamino)phenyl]ethenyl]-5-(phenoxycarbonylamino)benzenesulfonate (PubChem CID 171353983) has the molecular formula C30H26N2O10S2 and a molecular weight of 638.68 g/mol. Its IUPAC name is methyl 2-[(E)-2-[2-methoxysulfonyl-4-(phenoxycarbonylamino)phenyl]ethenyl]-5-(phenoxycarbonylamino)benzenesulfonate.
| Compound Name | methyl 2-[(E)-2-[2-methoxysulfonyl-4-(phenoxycarbonylamino)phenyl]ethenyl]-5-(phenoxycarbonylamino)benzenesulfonate |
|---|---|
| PubChem CID | 171353983 |
| Molecular Formula | C30H26N2O10S2 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.10 |
| IUPAC Name | methyl 2-[(E)-2-[2-methoxysulfonyl-4-(phenoxycarbonylamino)phenyl]ethenyl]-5-(phenoxycarbonylamino)benzenesulfonate |
| SMILES | COS(=O)(=O)c1cc(NC(=O)Oc2ccccc2)ccc1/C=C/c1ccc(NC(=O)Oc2ccccc2)cc1S(=O)(=O)OC |
| InChI | InChI=1S/C30H26N2O10S2/c1-39-43(35,36)27-19-23(31-29(33)41-25-9-5-3-6-10-25)17-15-21(27)13-14-22-16-18-24(20-28(22)44(37,38)40-2)32-30(34)42-26-11-7-4-8-12-26/h3-20H,1-2H3,(H,31,33)(H,32,34)/b14-13+ |
| InChIKey | APVFGQBHGWFIFM-BUHFOSPRSA-N |
| XLogP | 5.75 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|