About ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate
ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate (PubChem CID 178164704) has the molecular formula C16H18BrNO2
and a molecular weight of 336.23 g/mol. Its IUPAC name is ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate.
Molecular Properties
| Compound Name | ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate |
| PubChem CID | 178164704 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate |
| SMILES | CC.Cc1cc(NC(=O)Oc2ccccc2)ccc1Br |
| InChI | InChI=1S/C14H12BrNO2.C2H6/c1-10-9-11(7-8-13(10)15)16-14(17)18-12-5-3-2-4-6-12;1-2/h2-9H,1H3,(H,16,17);1-2H3 |
| InChIKey | PUEIQPTWLZNXIO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate?
The IUPAC name of ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate (CID 178164704) is ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate.
What is the SMILES notation for ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate?
The canonical SMILES for ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate is CC.Cc1cc(NC(=O)Oc2ccccc2)ccc1Br.
What is the InChIKey of ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate?
The InChIKey is PUEIQPTWLZNXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrNO2.C2H6/c1-10-9-11(7-8-13(10)15)16-14(17)18-12-5-3-2-4-6-12;1-2/h2-9H,1H3,(H,16,17);1-2H3.
What are the key properties of ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate?
ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate has a molecular weight of 336.23 g/mol, XLogP of 5.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;phenyl N-(4-bromo-3-methylphenyl)carbamate is sourced from PubChem (CID 178164704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).