C22H30N2O3S — CID 158211422
5-(tert-butylamino)-2-[(E)-2-[2-methyl-4-(propan-2-ylamino)phenyl]ethenyl]benzenesulfonic acid (PubChem CID 158211422) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 5-(tert-butylamino)-2-[(E)-2-[2-methyl-4-(propan-2-ylamino)phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-(tert-butylamino)-2-[(E)-2-[2-methyl-4-(propan-2-ylamino)phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 158211422 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 5-(tert-butylamino)-2-[(E)-2-[2-methyl-4-(propan-2-ylamino)phenyl]ethenyl]benzenesulfonic acid |
| SMILES | Cc1cc(NC(C)C)ccc1/C=C/c1ccc(NC(C)(C)C)cc1S(=O)(=O)O |
| InChI | InChI=1S/C22H30N2O3S/c1-15(2)23-19-11-9-17(16(3)13-19)7-8-18-10-12-20(24-22(4,5)6)14-21(18)28(25,26)27/h7-15,23-24H,1-6H3,(H,25,26,27)/b8-7+ |
| InChIKey | LTVDCVZDCIYTQY-BQYQJAHWSA-N |
| XLogP | 5.44 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|