C15H11NO5S — CID 56694105
3-(methylamino)-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 56694105) has the molecular formula C15H11NO5S and a molecular weight of 317.32 g/mol. Its IUPAC name is 3-(methylamino)-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 3-(methylamino)-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 56694105 |
| Molecular Formula | C15H11NO5S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-(methylamino)-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | CNc1cc2c(cc1S(=O)(=O)O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H11NO5S/c1-16-12-6-10-11(7-13(12)22(19,20)21)15(18)9-5-3-2-4-8(9)14(10)17/h2-7,16H,1H3,(H,19,20,21) |
| InChIKey | NQHZCWNLIPPORN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|