C15H13N3O4S — CID 129145165
4-amino-9-imino-1-(methylamino)-10-oxoanthracene-2-sulfonic acid (PubChem CID 129145165) has the molecular formula C15H13N3O4S and a molecular weight of 331.35 g/mol. Its IUPAC name is 4-amino-9-imino-1-(methylamino)-10-oxoanthracene-2-sulfonic acid.
| Compound Name | 4-amino-9-imino-1-(methylamino)-10-oxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 129145165 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-amino-9-imino-1-(methylamino)-10-oxoanthracene-2-sulfonic acid |
| SMILES | [H]/N=C1\c2ccccc2C(=O)c2c(N)cc(S(=O)(=O)O)c(NC)c21 |
| InChI | InChI=1S/C15H13N3O4S/c1-18-14-10(23(20,21)22)6-9(16)11-12(14)13(17)7-4-2-3-5-8(7)15(11)19/h2-6,17-18H,16H2,1H3,(H,20,21,22)/b17-13+ |
| InChIKey | QEKRGODDLHTQEK-GHRIWEEISA-N |
| XLogP | 1.52 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|