C15H9BrN2O5S2 — CID 169359908
4-bromo-1-(carbamothioylamino)-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 169359908) has the molecular formula C15H9BrN2O5S2 and a molecular weight of 441.28 g/mol. Its IUPAC name is 4-bromo-1-(carbamothioylamino)-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 4-bromo-1-(carbamothioylamino)-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 169359908 |
| Molecular Formula | C15H9BrN2O5S2 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 439.91 |
| IUPAC Name | 4-bromo-1-(carbamothioylamino)-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | NC(=S)Nc1c(S(=O)(=O)O)cc(Br)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H9BrN2O5S2/c16-8-5-9(25(21,22)23)12(18-15(17)24)11-10(8)13(19)6-3-1-2-4-7(6)14(11)20/h1-5H,(H3,17,18,24)(H,21,22,23) |
| InChIKey | SKSVZLKIQWARKW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|