C21H12BrN3O7S — CID 168550155
1-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-4-bromo-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 168550155) has the molecular formula C21H12BrN3O7S and a molecular weight of 530.31 g/mol. Its IUPAC name is 1-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-4-bromo-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-4-bromo-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 168550155 |
| Molecular Formula | C21H12BrN3O7S |
| Molecular Weight | 530.31 g/mol |
| Exact Mass | 528.96 |
| IUPAC Name | 1-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-4-bromo-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1c(S(=O)(=O)O)cc(Br)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H12BrN3O7S/c1-32-21(28)18-16(24)9(7-23)8-25(18)17-13(33(29,30)31)6-12(22)14-15(17)20(27)11-5-3-2-4-10(11)19(14)26/h2-6,8H,24H2,1H3,(H,29,30,31) |
| InChIKey | RTMBTJOZYWGSJI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|