C17H13N3O5S — CID 168550157
2-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)naphthalene-1-sulfonic acid (PubChem CID 168550157) has the molecular formula C17H13N3O5S and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)naphthalene-1-sulfonic acid.
| Compound Name | 2-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 168550157 |
| Molecular Formula | C17H13N3O5S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)naphthalene-1-sulfonic acid |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc2ccccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C17H13N3O5S/c1-25-17(21)15-14(19)11(8-18)9-20(15)13-7-6-10-4-2-3-5-12(10)16(13)26(22,23)24/h2-7,9H,19H2,1H3,(H,22,23,24) |
| InChIKey | SBZGHMKSLLKAIC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|