C16H16N4O3 — CID 168548008
methyl 3-amino-4-cyano-1-[2-[2-(methylamino)-2-oxoethyl]phenyl]pyrrole-2-carboxylate (PubChem CID 168548008) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[2-[2-(methylamino)-2-oxoethyl]phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[2-[2-(methylamino)-2-oxoethyl]phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548008 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[2-[2-(methylamino)-2-oxoethyl]phenyl]pyrrole-2-carboxylate |
| SMILES | CNC(=O)Cc1ccccc1-n1cc(C#N)c(N)c1C(=O)OC |
| InChI | InChI=1S/C16H16N4O3/c1-19-13(21)7-10-5-3-4-6-12(10)20-9-11(8-17)14(18)15(20)16(22)23-2/h3-6,9H,7,18H2,1-2H3,(H,19,21) |
| InChIKey | DETLTNSNLIGOIC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |