C21H17N3O4 — CID 168549249
methyl 3-amino-4-cyano-1-(2-phenylmethoxycarbonylphenyl)pyrrole-2-carboxylate (PubChem CID 168549249) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(2-phenylmethoxycarbonylphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(2-phenylmethoxycarbonylphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549249 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(2-phenylmethoxycarbonylphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccccc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H17N3O4/c1-27-21(26)19-18(23)15(11-22)12-24(19)17-10-6-5-9-16(17)20(25)28-13-14-7-3-2-4-8-14/h2-10,12H,13,23H2,1H3 |
| InChIKey | MMTDOIJNHMUCCM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |