C19H11N3O5 — CID 168547352
methyl 3-amino-4-cyano-1-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)pyrrole-2-carboxylate (PubChem CID 168547352) has the molecular formula C19H11N3O5 and a molecular weight of 361.31 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547352 |
| Molecular Formula | C19H11N3O5 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc2c3c(cccc13)C(=O)OC2=O |
| InChI | InChI=1S/C19H11N3O5/c1-26-19(25)16-15(21)9(7-20)8-22(16)13-6-5-12-14-10(13)3-2-4-11(14)17(23)27-18(12)24/h2-6,8H,21H2,1H3 |
| InChIKey | HVLWDHDVVGPOQH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|