C16H11BrN2O6S — CID 19851230
5-acetamido-1-amino-4-bromo-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 19851230) has the molecular formula C16H11BrN2O6S and a molecular weight of 439.24 g/mol. Its IUPAC name is 5-acetamido-1-amino-4-bromo-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 5-acetamido-1-amino-4-bromo-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 19851230 |
| Molecular Formula | C16H11BrN2O6S |
| Molecular Weight | 439.24 g/mol |
| Exact Mass | 437.95 |
| IUPAC Name | 5-acetamido-1-amino-4-bromo-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | CC(=O)Nc1cccc2c1C(=O)c1c(Br)cc(S(=O)(=O)O)c(N)c1C2=O |
| InChI | InChI=1S/C16H11BrN2O6S/c1-6(20)19-9-4-2-3-7-11(9)16(22)12-8(17)5-10(26(23,24)25)14(18)13(12)15(7)21/h2-5H,18H2,1H3,(H,19,20)(H,23,24,25) |
| InChIKey | ARTYZVXYSQZJOT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|