C17H12BrNO3 — CID 70367157
N-(4-bromo-1-methyl-9,10-dioxoanthracen-2-yl)acetamide (PubChem CID 70367157) has the molecular formula C17H12BrNO3 and a molecular weight of 358.19 g/mol. Its IUPAC name is N-(4-bromo-1-methyl-9,10-dioxoanthracen-2-yl)acetamide.
| Compound Name | N-(4-bromo-1-methyl-9,10-dioxoanthracen-2-yl)acetamide |
|---|---|
| PubChem CID | 70367157 |
| Molecular Formula | C17H12BrNO3 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-(4-bromo-1-methyl-9,10-dioxoanthracen-2-yl)acetamide |
| SMILES | CC(=O)Nc1cc(Br)c2c(c1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H12BrNO3/c1-8-13(19-9(2)20)7-12(18)15-14(8)16(21)10-5-3-4-6-11(10)17(15)22/h3-7H,1-2H3,(H,19,20) |
| InChIKey | FYEFOWXVZVDRNN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|