C19H14BrNO4 — CID 5083109
N-(4-bromo-2-methyl-9,10-dioxoanthracen-1-yl)-3-oxobutanamide (PubChem CID 5083109) has the molecular formula C19H14BrNO4 and a molecular weight of 400.23 g/mol. Its IUPAC name is N-(4-bromo-2-methyl-9,10-dioxoanthracen-1-yl)-3-oxobutanamide.
| Compound Name | N-(4-bromo-2-methyl-9,10-dioxoanthracen-1-yl)-3-oxobutanamide |
|---|---|
| PubChem CID | 5083109 |
| Molecular Formula | C19H14BrNO4 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | N-(4-bromo-2-methyl-9,10-dioxoanthracen-1-yl)-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)Nc1c(C)cc(Br)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H14BrNO4/c1-9-7-13(20)15-16(17(9)21-14(23)8-10(2)22)19(25)12-6-4-3-5-11(12)18(15)24/h3-7H,8H2,1-2H3,(H,21,23) |
| InChIKey | IIPHIPOILNGINS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|